C45H41F9O8S2 — CID 139785810
[bis[4-(2-ethoxyethoxy)phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 139785810) has the molecular formula C45H41F9O8S2 and a molecular weight of 944.93 g/mol. Its IUPAC name is [bis[4-(2-ethoxyethoxy)phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [bis[4-(2-ethoxyethoxy)phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 139785810 |
| Molecular Formula | C45H41F9O8S2 |
| Molecular Weight | 944.93 g/mol |
| Exact Mass | 944.21 |
| IUPAC Name | [bis[4-(2-ethoxyethoxy)phenyl]-[4-(phenanthren-9-ylmethoxy)phenyl]-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | CCOCCOc1ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c2ccc(OCCOCC)cc2)c2ccc(OCc3cc4ccccc4c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C45H41F9O8S2/c1-3-57-25-27-59-33-13-19-36(20-14-33)63(37-21-15-34(16-22-37)60-28-26-58-4-2,62-64(55,56)45(53,54)43(48,49)42(46,47)44(50,51)52)38-23-17-35(18-24-38)61-30-32-29-31-9-5-6-10-39(31)41-12-8-7-11-40(32)41/h5-24,29H,3-4,25-28,30H2,1-2H3 |
| InChIKey | HEAAFHCEPOVGBW-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.93 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|