C22H23N5O — CID 139785898
6-methyl-3-[1-(6-methylquinazolin-4-yl)piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 139785898) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 6-methyl-3-[1-(6-methylquinazolin-4-yl)piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 6-methyl-3-[1-(6-methylquinazolin-4-yl)piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 139785898 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 6-methyl-3-[1-(6-methylquinazolin-4-yl)piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | Cc1ccc2c(c1)[nH]c(=O)n2C1CCN(c2ncnc3ccc(C)cc23)CC1 |
| InChI | InChI=1S/C22H23N5O/c1-14-3-5-18-17(11-14)21(24-13-23-18)26-9-7-16(8-10-26)27-20-6-4-15(2)12-19(20)25-22(27)28/h3-6,11-13,16H,7-10H2,1-2H3,(H,25,28) |
| InChIKey | ZRXYOZOVCMAHIO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |