C23H48N4 — CID 139785969
1-N,1-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)pentane-1,3-diamine (PubChem CID 139785969) has the molecular formula C23H48N4 and a molecular weight of 380.67 g/mol. Its IUPAC name is 1-N,1-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)pentane-1,3-diamine.
| Compound Name | 1-N,1-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)pentane-1,3-diamine |
|---|---|
| PubChem CID | 139785969 |
| Molecular Formula | C23H48N4 |
| Molecular Weight | 380.67 g/mol |
| Exact Mass | 380.39 |
| IUPAC Name | 1-N,1-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)pentane-1,3-diamine |
| SMILES | CCC(N)CCN(C1CC(C)(C)NC(C)(C)C1)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C23H48N4/c1-10-17(24)11-12-27(18-13-20(2,3)25-21(4,5)14-18)19-15-22(6,7)26-23(8,9)16-19/h17-19,25-26H,10-16,24H2,1-9H3 |
| InChIKey | YIWHFLCNIHIQJM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.67 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |