About 3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene
3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene (PubChem CID 139787035) has the molecular formula C5H4N2
and a molecular weight of 92.10 g/mol. Its IUPAC name is 3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene.
Molecular Properties
| Compound Name | 3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene |
| PubChem CID | 139787035 |
| Molecular Formula | C5H4N2 |
| Molecular Weight | 92.10 g/mol |
| Exact Mass | 92.04 |
| IUPAC Name | 3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene |
| SMILES | c1cc2c(cn1)N2 |
| InChI | InChI=1S/C5H4N2/c1-2-6-3-5-4(1)7-5/h1-3,7H |
| InChIKey | HQQLMOGBCKWVLB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 34.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.10 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene?
The IUPAC name of 3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene (CID 139787035) is 3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene.
What is the SMILES notation for 3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene?
The canonical SMILES for 3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene is c1cc2c(cn1)N2.
What is the InChIKey of 3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene?
The InChIKey is HQQLMOGBCKWVLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2/c1-2-6-3-5-4(1)7-5/h1-3,7H.
What are the key properties of 3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene?
3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene has a molecular weight of 92.10 g/mol, XLogP of 1.14, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-diazabicyclo[4.1.0]hepta-1(6),2,4-triene is sourced from PubChem (CID 139787035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).