About N"-octylmethanetriamine
N"-octylmethanetriamine (PubChem CID 139788026) has the molecular formula C9H23N3
and a molecular weight of 173.30 g/mol. Its IUPAC name is N"-octylmethanetriamine.
Molecular Properties
| Compound Name | N"-octylmethanetriamine |
| PubChem CID | 139788026 |
| Molecular Formula | C9H23N3 |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.19 |
| IUPAC Name | N"-octylmethanetriamine |
| SMILES | CCCCCCCCNC(N)N |
| InChI | InChI=1S/C9H23N3/c1-2-3-4-5-6-7-8-12-9(10)11/h9,12H,2-8,10-11H2,1H3 |
| InChIKey | WKRZISGSNKKDTD-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N"-octylmethanetriamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N"-octylmethanetriamine?
The IUPAC name of N"-octylmethanetriamine (CID 139788026) is N"-octylmethanetriamine.
What is the SMILES notation for N"-octylmethanetriamine?
The canonical SMILES for N"-octylmethanetriamine is CCCCCCCCNC(N)N.
What is the InChIKey of N"-octylmethanetriamine?
The InChIKey is WKRZISGSNKKDTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H23N3/c1-2-3-4-5-6-7-8-12-9(10)11/h9,12H,2-8,10-11H2,1H3.
What are the key properties of N"-octylmethanetriamine?
N"-octylmethanetriamine has a molecular weight of 173.30 g/mol, XLogP of 1.14, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N"-octylmethanetriamine is sourced from PubChem (CID 139788026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).