C90H102N6O12 — CID 139789428
N-[5-[3,6,7,10,11-pentakis(5-benzamidopentoxy)triphenylen-2-yl]oxypentyl]benzamide (PubChem CID 139789428) has the molecular formula C90H102N6O12 and a molecular weight of 1459.84 g/mol. Its IUPAC name is N-[5-[3,6,7,10,11-pentakis(5-benzamidopentoxy)triphenylen-2-yl]oxypentyl]benzamide.
| Compound Name | N-[5-[3,6,7,10,11-pentakis(5-benzamidopentoxy)triphenylen-2-yl]oxypentyl]benzamide |
|---|---|
| PubChem CID | 139789428 |
| Molecular Formula | C90H102N6O12 |
| Molecular Weight | 1459.84 g/mol |
| Exact Mass | 1458.76 |
| IUPAC Name | N-[5-[3,6,7,10,11-pentakis(5-benzamidopentoxy)triphenylen-2-yl]oxypentyl]benzamide |
| SMILES | O=C(NCCCCCOc1cc2c3cc(OCCCCCNC(=O)c4ccccc4)c(OCCCCCNC(=O)c4ccccc4)cc3c3cc(OCCCCCNC(=O)c4ccccc4)c(OCCCCCNC(=O)c4ccccc4)cc3c2cc1OCCCCCNC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C90H102N6O12/c97-85(67-37-13-1-14-38-67)91-49-25-7-31-55-103-79-61-73-74(62-80(79)104-56-32-8-26-50-92-86(98)68-39-15-2-16-40-68)76-64-82(106-58-34-10-28-52-94-88(100)70-43-19-4-20-44-70)84(108-60-36-12-30-54-96-90(102)72-47-23-6-24-48-72)66-78(76)77-65-83(107-59-35-11-29-53-95-89(101)71-45-21-5-22-46-71)81(63-75(73)77)105-57-33-9-27-51-93-87(99)69-41-17-3-18-42-69/h1-6,13-24,37-48,61-66H,7-12,25-36,49-60H2,(H,91,97)(H,92,98)(H,93,99)(H,94,100)(H,95,101)(H,96,102) |
| InChIKey | NAOOHDSKPKIZEI-UHFFFAOYSA-N |
| XLogP | 17.02 |
| TPSA | 229.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 108 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1459.84 |
| LogP ≤ 5 | 17.02 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|