C38H39ClF3N3O2 — CID 139789541
9-[4-[3-[(3-oxo-1H-benzo[f]isoindol-2-yl)methyl]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide;hydrochloride (PubChem CID 139789541) has the molecular formula C38H39ClF3N3O2 and a molecular weight of 662.20 g/mol. Its IUPAC name is 9-[4-[3-[(3-oxo-1H-benzo[f]isoindol-2-yl)methyl]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide;hydrochloride.
| Compound Name | 9-[4-[3-[(3-oxo-1H-benzo[f]isoindol-2-yl)methyl]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 139789541 |
| Molecular Formula | C38H39ClF3N3O2 |
| Molecular Weight | 662.20 g/mol |
| Exact Mass | 661.27 |
| IUPAC Name | 9-[4-[3-[(3-oxo-1H-benzo[f]isoindol-2-yl)methyl]piperidin-1-yl]butyl]-N-(2,2,2-trifluoroethyl)fluorene-9-carboxamide;hydrochloride |
| SMILES | Cl.O=C1c2cc3ccccc3cc2CN1CC1CCCN(CCCCC2(C(=O)NCC(F)(F)F)c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C38H38F3N3O2.ClH/c39-38(40,41)25-42-36(46)37(33-15-5-3-13-30(33)31-14-4-6-16-34(31)37)17-7-8-18-43-19-9-10-26(22-43)23-44-24-29-20-27-11-1-2-12-28(27)21-32(29)35(44)45;/h1-6,11-16,20-21,26H,7-10,17-19,22-25H2,(H,42,46);1H |
| InChIKey | ZELCNEQWNZGNLL-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.20 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|