C16H22O3 — CID 139790183
(1R,2S,3R)-1-(4-methoxybutyl)-2-phenylcyclopent-4-ene-1,3-diol (PubChem CID 139790183) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (1R,2S,3R)-1-(4-methoxybutyl)-2-phenylcyclopent-4-ene-1,3-diol.
| Compound Name | (1R,2S,3R)-1-(4-methoxybutyl)-2-phenylcyclopent-4-ene-1,3-diol |
|---|---|
| PubChem CID | 139790183 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (1R,2S,3R)-1-(4-methoxybutyl)-2-phenylcyclopent-4-ene-1,3-diol |
| SMILES | COCCCC[C@@]1(O)C=C[C@@H](O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H22O3/c1-19-12-6-5-10-16(18)11-9-14(17)15(16)13-7-3-2-4-8-13/h2-4,7-9,11,14-15,17-18H,5-6,10,12H2,1H3/t14-,15+,16-/m1/s1 |
| InChIKey | PVAGDGRXMWCCRD-OWCLPIDISA-N |
| XLogP | 2.25 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|