C21H28O5 — CID 139790242
[2-ethyl-5-[[(1S)-2-oxocyclopentyl]methyl]phenyl] 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate (PubChem CID 139790242) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is [2-ethyl-5-[[(1S)-2-oxocyclopentyl]methyl]phenyl] 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate.
| Compound Name | [2-ethyl-5-[[(1S)-2-oxocyclopentyl]methyl]phenyl] 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
|---|---|
| PubChem CID | 139790242 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [2-ethyl-5-[[(1S)-2-oxocyclopentyl]methyl]phenyl] 2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]acetate |
| SMILES | CCc1ccc(C[C@@H]2CCCC2=O)cc1OC(=O)C[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C21H28O5/c1-4-15-9-8-14(10-16-6-5-7-18(16)22)11-19(15)25-20(23)12-17-13-24-21(2,3)26-17/h8-9,11,16-17H,4-7,10,12-13H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | FPAZJHKZRNYBOQ-IRXDYDNUSA-N |
| XLogP | 3.61 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|