C12H18ClNO2S — CID 139790422
3-(1-chloroethylsulfonyl)-1-(2-methylphenyl)propan-1-amine (PubChem CID 139790422) has the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. Its IUPAC name is 3-(1-chloroethylsulfonyl)-1-(2-methylphenyl)propan-1-amine.
| Compound Name | 3-(1-chloroethylsulfonyl)-1-(2-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 139790422 |
| Molecular Formula | C12H18ClNO2S |
| Molecular Weight | 275.80 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 3-(1-chloroethylsulfonyl)-1-(2-methylphenyl)propan-1-amine |
| SMILES | Cc1ccccc1C(N)CCS(=O)(=O)C(C)Cl |
| InChI | InChI=1S/C12H18ClNO2S/c1-9-5-3-4-6-11(9)12(14)7-8-17(15,16)10(2)13/h3-6,10,12H,7-8,14H2,1-2H3 |
| InChIKey | MVCDKZVPOXNYMI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.80 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|