C11H5F3O3 — CID 139790785
3-(2,2,2-trifluoroacetyl)cyclohepta[b]furan-2-one (PubChem CID 139790785) has the molecular formula C11H5F3O3 and a molecular weight of 242.15 g/mol. Its IUPAC name is 3-(2,2,2-trifluoroacetyl)cyclohepta[b]furan-2-one.
| Compound Name | 3-(2,2,2-trifluoroacetyl)cyclohepta[b]furan-2-one |
|---|---|
| PubChem CID | 139790785 |
| Molecular Formula | C11H5F3O3 |
| Molecular Weight | 242.15 g/mol |
| Exact Mass | 242.02 |
| IUPAC Name | 3-(2,2,2-trifluoroacetyl)cyclohepta[b]furan-2-one |
| SMILES | O=C(c1c2cccccc-2oc1=O)C(F)(F)F |
| InChI | InChI=1S/C11H5F3O3/c12-11(13,14)9(15)8-6-4-2-1-3-5-7(6)17-10(8)16/h1-5H |
| InChIKey | OTZGAAYZCKJPJY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.15 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |