About 6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine
6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine (PubChem CID 139790844) has the molecular formula C12H14BrFN2
and a molecular weight of 285.16 g/mol. Its IUPAC name is 6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine.
Molecular Properties
| Compound Name | 6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine |
| PubChem CID | 139790844 |
| Molecular Formula | C12H14BrFN2 |
| Molecular Weight | 285.16 g/mol |
| Exact Mass | 284.03 |
| IUPAC Name | 6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine |
| SMILES | FCCN1CCCC(c2ccc(Br)cc2)=N1 |
| InChI | InChI=1S/C12H14BrFN2/c13-11-5-3-10(4-6-11)12-2-1-8-16(15-12)9-7-14/h3-6H,1-2,7-9H2 |
| InChIKey | FRUHQYCEVFVNLT-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.16 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine?
The IUPAC name of 6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine (CID 139790844) is 6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine.
What is the SMILES notation for 6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine?
The canonical SMILES for 6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine is FCCN1CCCC(c2ccc(Br)cc2)=N1.
What is the InChIKey of 6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine?
The InChIKey is FRUHQYCEVFVNLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrFN2/c13-11-5-3-10(4-6-11)12-2-1-8-16(15-12)9-7-14/h3-6H,1-2,7-9H2.
What are the key properties of 6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine?
6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine has a molecular weight of 285.16 g/mol, XLogP of 3.22, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-bromophenyl)-2-(2-fluoroethyl)-4,5-dihydro-3H-pyridazine is sourced from PubChem (CID 139790844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).