C18H8Cl8N2O2 — CID 139791103
3-[3-(3-amino-2,4,6-trichlorophenoxy)-2,4-dichlorophenoxy]-2,4,6-trichloroaniline (PubChem CID 139791103) has the molecular formula C18H8Cl8N2O2 and a molecular weight of 567.90 g/mol. Its IUPAC name is 3-[3-(3-amino-2,4,6-trichlorophenoxy)-2,4-dichlorophenoxy]-2,4,6-trichloroaniline.
| Compound Name | 3-[3-(3-amino-2,4,6-trichlorophenoxy)-2,4-dichlorophenoxy]-2,4,6-trichloroaniline |
|---|---|
| PubChem CID | 139791103 |
| Molecular Formula | C18H8Cl8N2O2 |
| Molecular Weight | 567.90 g/mol |
| Exact Mass | 563.81 |
| IUPAC Name | 3-[3-(3-amino-2,4,6-trichlorophenoxy)-2,4-dichlorophenoxy]-2,4,6-trichloroaniline |
| SMILES | Nc1c(Cl)cc(Cl)c(Oc2ccc(Cl)c(Oc3c(Cl)cc(Cl)c(N)c3Cl)c2Cl)c1Cl |
| InChI | InChI=1S/C18H8Cl8N2O2/c19-5-1-2-10(29-17-8(22)3-6(20)14(27)12(17)25)11(24)16(5)30-18-9(23)4-7(21)15(28)13(18)26/h1-4H,27-28H2 |
| InChIKey | XKASZVBJBOWGHV-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.90 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|