C25H22N2O2 — CID 139791360
2,4,5,9,11-pentamethyl-12H-quinolino[2,3-b]acridine-7,14-dione (PubChem CID 139791360) has the molecular formula C25H22N2O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2,4,5,9,11-pentamethyl-12H-quinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 2,4,5,9,11-pentamethyl-12H-quinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 139791360 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 2,4,5,9,11-pentamethyl-12H-quinolino[2,3-b]acridine-7,14-dione |
| SMILES | Cc1cc(C)c2[nH]c3cc4c(=O)c5cc(C)cc(C)c5n(C)c4cc3c(=O)c2c1 |
| InChI | InChI=1S/C25H22N2O2/c1-12-6-14(3)22-18(8-12)24(28)16-11-21-17(10-20(16)26-22)25(29)19-9-13(2)7-15(4)23(19)27(21)5/h6-11H,1-5H3,(H,26,28) |
| InChIKey | WUGPZNNSIUKJAW-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|