C20H22F2N4O4 — CID 139791902
5-amino-7-(3-amino-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl)-6-fluoro-1-(2-fluorocyclopropyl)-8-methyl-4-oxoquinoline-3-carboxylic acid (PubChem CID 139791902) has the molecular formula C20H22F2N4O4 and a molecular weight of 420.42 g/mol. Its IUPAC name is 5-amino-7-(3-amino-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl)-6-fluoro-1-(2-fluorocyclopropyl)-8-methyl-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 5-amino-7-(3-amino-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl)-6-fluoro-1-(2-fluorocyclopropyl)-8-methyl-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 139791902 |
| Molecular Formula | C20H22F2N4O4 |
| Molecular Weight | 420.42 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 5-amino-7-(3-amino-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrol-1-yl)-6-fluoro-1-(2-fluorocyclopropyl)-8-methyl-4-oxoquinoline-3-carboxylic acid |
| SMILES | Cc1c(N2CC(N)C3COCC32)c(F)c(N)c2c(=O)c(C(=O)O)cn(C3CC3F)c12 |
| InChI | InChI=1S/C20H22F2N4O4/c1-7-17-14(19(27)8(20(28)29)3-25(17)12-2-10(12)21)16(24)15(22)18(7)26-4-11(23)9-5-30-6-13(9)26/h3,9-13H,2,4-6,23-24H2,1H3,(H,28,29) |
| InChIKey | HPGRCTPYMBGUTL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|