About (7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione
(7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione (PubChem CID 139792559) has the molecular formula C14H28O4Si
and a molecular weight of 288.46 g/mol. Its IUPAC name is (7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione.
Molecular Properties
| Compound Name | (7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione |
| PubChem CID | 139792559 |
| Molecular Formula | C14H28O4Si |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione |
| SMILES | CC(=O)C(=O)CCC[C@H](O)C(O)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H28O4Si/c1-10(15)11(16)8-7-9-12(17)13(18)19(5,6)14(2,3)4/h12-13,17-18H,7-9H2,1-6H3/t12-,13?/m0/s1 |
| InChIKey | HNSJCTNOICIQEF-UEWDXFNNSA-N |
| XLogP | 2.08 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione?
The IUPAC name of (7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione (CID 139792559) is (7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione.
What is the SMILES notation for (7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione?
The canonical SMILES for (7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione is CC(=O)C(=O)CCC[C@H](O)C(O)[Si](C)(C)C(C)(C)C.
What is the InChIKey of (7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione?
The InChIKey is HNSJCTNOICIQEF-UEWDXFNNSA-N. The full InChI is InChI=1S/C14H28O4Si/c1-10(15)11(16)8-7-9-12(17)13(18)19(5,6)14(2,3)4/h12-13,17-18H,7-9H2,1-6H3/t12-,13?/m0/s1.
What are the key properties of (7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione?
(7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione has a molecular weight of 288.46 g/mol, XLogP of 2.08, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-8-[tert-butyl(dimethyl)silyl]-7,8-dihydroxyoctane-2,3-dione is sourced from PubChem (CID 139792559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).