C15H14N4O — CID 139793070
13-(2-aminoethyl)-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one (PubChem CID 139793070) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 13-(2-aminoethyl)-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one.
| Compound Name | 13-(2-aminoethyl)-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one |
|---|---|
| PubChem CID | 139793070 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 13-(2-aminoethyl)-2,5,8-triazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),3,5,10(15),11,13-hexaen-7-one |
| SMILES | NCCc1ccc2c(c1)Cc1c-2[nH]c(=O)c2nccn12 |
| InChI | InChI=1S/C15H14N4O/c16-4-3-9-1-2-11-10(7-9)8-12-13(11)18-15(20)14-17-5-6-19(12)14/h1-2,5-7H,3-4,8,16H2,(H,18,20) |
| InChIKey | PCKYLHFLGPQMGI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |