C8H4F12O2 — CID 139793143
2,4,4,5,5,5-hexafluoro-2-(2,2,3,3,3-pentafluoropropoxy)pentanoyl fluoride (PubChem CID 139793143) has the molecular formula C8H4F12O2 and a molecular weight of 360.09 g/mol. Its IUPAC name is 2,4,4,5,5,5-hexafluoro-2-(2,2,3,3,3-pentafluoropropoxy)pentanoyl fluoride.
| Compound Name | 2,4,4,5,5,5-hexafluoro-2-(2,2,3,3,3-pentafluoropropoxy)pentanoyl fluoride |
|---|---|
| PubChem CID | 139793143 |
| Molecular Formula | C8H4F12O2 |
| Molecular Weight | 360.09 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 2,4,4,5,5,5-hexafluoro-2-(2,2,3,3,3-pentafluoropropoxy)pentanoyl fluoride |
| SMILES | O=C(F)C(F)(CC(F)(F)C(F)(F)F)OCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4F12O2/c9-3(21)4(10,1-5(11,12)7(15,16)17)22-2-6(13,14)8(18,19)20/h1-2H2 |
| InChIKey | YNZWUTOBPJSXDS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.09 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|