C15H14Cl2O3 — CID 139794539
1,1-bis(2-chlorophenoxy)propan-1-ol (PubChem CID 139794539) has the molecular formula C15H14Cl2O3 and a molecular weight of 313.18 g/mol. Its IUPAC name is 1,1-bis(2-chlorophenoxy)propan-1-ol.
| Compound Name | 1,1-bis(2-chlorophenoxy)propan-1-ol |
|---|---|
| PubChem CID | 139794539 |
| Molecular Formula | C15H14Cl2O3 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 1,1-bis(2-chlorophenoxy)propan-1-ol |
| SMILES | CCC(O)(Oc1ccccc1Cl)Oc1ccccc1Cl |
| InChI | InChI=1S/C15H14Cl2O3/c1-2-15(18,19-13-9-5-3-7-11(13)16)20-14-10-6-4-8-12(14)17/h3-10,18H,2H2,1H3 |
| InChIKey | NMMJFNMYTGRMSA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|