C24H27IO4 — CID 139794615
methyl 3-iodo-2-[2-oxo-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]benzoate (PubChem CID 139794615) has the molecular formula C24H27IO4 and a molecular weight of 506.38 g/mol. Its IUPAC name is methyl 3-iodo-2-[2-oxo-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]benzoate.
| Compound Name | methyl 3-iodo-2-[2-oxo-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]benzoate |
|---|---|
| PubChem CID | 139794615 |
| Molecular Formula | C24H27IO4 |
| Molecular Weight | 506.38 g/mol |
| Exact Mass | 506.10 |
| IUPAC Name | methyl 3-iodo-2-[2-oxo-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethoxy]benzoate |
| SMILES | COC(=O)c1cccc(I)c1OCC(=O)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C24H27IO4/c1-23(2)11-12-24(3,4)18-13-15(9-10-17(18)23)20(26)14-29-21-16(22(27)28-5)7-6-8-19(21)25/h6-10,13H,11-12,14H2,1-5H3 |
| InChIKey | WOLHWQYLFMMITN-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.38 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|