C18H30O9 — CID 139794771
9-[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]carbonylundec-10-enoic acid (PubChem CID 139794771) has the molecular formula C18H30O9 and a molecular weight of 390.43 g/mol. Its IUPAC name is 9-[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]carbonylundec-10-enoic acid.
| Compound Name | 9-[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]carbonylundec-10-enoic acid |
|---|---|
| PubChem CID | 139794771 |
| Molecular Formula | C18H30O9 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 9-[(2R,3R,4S,5R)-2,3,4,5-tetrahydroxy-6-oxohexoxy]carbonylundec-10-enoic acid |
| SMILES | C=CC(CCCCCCCC(=O)O)C(=O)OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O |
| InChI | InChI=1S/C18H30O9/c1-2-12(8-6-4-3-5-7-9-15(22)23)18(26)27-11-14(21)17(25)16(24)13(20)10-19/h2,10,12-14,16-17,20-21,24-25H,1,3-9,11H2,(H,22,23)/t12?,13-,14+,16+,17+/m0/s1 |
| InChIKey | GQPLKKXMIFRNOA-NTADBXQRSA-N |
| XLogP | -0.21 |
| TPSA | 161.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|