C15H12F6N2O4 — CID 139795016
3-amino-5-[2-(3-amino-4,5-dihydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene-1,2-diol (PubChem CID 139795016) has the molecular formula C15H12F6N2O4 and a molecular weight of 398.26 g/mol. Its IUPAC name is 3-amino-5-[2-(3-amino-4,5-dihydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene-1,2-diol.
| Compound Name | 3-amino-5-[2-(3-amino-4,5-dihydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 139795016 |
| Molecular Formula | C15H12F6N2O4 |
| Molecular Weight | 398.26 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 3-amino-5-[2-(3-amino-4,5-dihydroxyphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]benzene-1,2-diol |
| SMILES | Nc1cc(C(c2cc(N)c(O)c(O)c2)(C(F)(F)F)C(F)(F)F)cc(O)c1O |
| InChI | InChI=1S/C15H12F6N2O4/c16-14(17,18)13(15(19,20)21,5-1-7(22)11(26)9(24)3-5)6-2-8(23)12(27)10(25)4-6/h1-4,24-27H,22-23H2 |
| InChIKey | FOVFSYVWKPBCOF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|