C25H11F17N2O5 — CID 139795194
1-[3-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-4-(3-methylidene-2,5-dioxopyrrolidin-1-yl)phenyl]-3-methylidenepyrrolidine-2,5-dione (PubChem CID 139795194) has the molecular formula C25H11F17N2O5 and a molecular weight of 742.34 g/mol. Its IUPAC name is 1-[3-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-4-(3-methylidene-2,5-dioxopyrrolidin-1-yl)phenyl]-3-methylidenepyrrolidine-2,5-dione.
| Compound Name | 1-[3-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-4-(3-methylidene-2,5-dioxopyrrolidin-1-yl)phenyl]-3-methylidenepyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 139795194 |
| Molecular Formula | C25H11F17N2O5 |
| Molecular Weight | 742.34 g/mol |
| Exact Mass | 742.04 |
| IUPAC Name | 1-[3-(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)-4-(3-methylidene-2,5-dioxopyrrolidin-1-yl)phenyl]-3-methylidenepyrrolidine-2,5-dione |
| SMILES | C=C1CC(=O)N(c2ccc(N3C(=O)CC(=C)C3=O)c(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C25H11F17N2O5/c1-8-5-13(45)43(17(8)47)10-3-4-11(44-14(46)6-9(2)18(44)48)12(7-10)49-16(27)15(26)19(28,29)20(30,31)21(32,33)22(34,35)23(36,37)24(38,39)25(40,41)42/h3-4,7H,1-2,5-6H2 |
| InChIKey | QTYWJPKSTCVZCV-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.34 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|