C22H21Cl2N5O3 — CID 1397954
4-[2-[[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-9H-purin-7-ium-8-yl]amino]ethyl]phenolate (PubChem CID 1397954) has the molecular formula C22H21Cl2N5O3 and a molecular weight of 474.35 g/mol. Its IUPAC name is 4-[2-[[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-9H-purin-7-ium-8-yl]amino]ethyl]phenolate.
| Compound Name | 4-[2-[[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-9H-purin-7-ium-8-yl]amino]ethyl]phenolate |
|---|---|
| PubChem CID | 1397954 |
| Molecular Formula | C22H21Cl2N5O3 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 473.10 |
| IUPAC Name | 4-[2-[[7-[(2,4-dichlorophenyl)methyl]-1,3-dimethyl-2,6-dioxo-9H-purin-7-ium-8-yl]amino]ethyl]phenolate |
| SMILES | Cn1c(=O)c2c([nH]c(NCCc3ccc([O-])cc3)[n+]2Cc2ccc(Cl)cc2Cl)n(C)c1=O |
| InChI | InChI=1S/C22H21Cl2N5O3/c1-27-19-18(20(31)28(2)22(27)32)29(12-14-5-6-15(23)11-17(14)24)21(26-19)25-10-9-13-3-7-16(30)8-4-13/h3-8,11H,9-10,12H2,1-2H3,(H2,25,26,30,31) |
| InChIKey | KZIWQBKOXAOVPX-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 98.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|