C14H20O6S — CID 139795982
(3R,4S,5S)-2-(benzenesulfinyl)-3,4,5-trimethoxyoxan-2-ol (PubChem CID 139795982) has the molecular formula C14H20O6S and a molecular weight of 316.38 g/mol. Its IUPAC name is (3R,4S,5S)-2-(benzenesulfinyl)-3,4,5-trimethoxyoxan-2-ol.
| Compound Name | (3R,4S,5S)-2-(benzenesulfinyl)-3,4,5-trimethoxyoxan-2-ol |
|---|---|
| PubChem CID | 139795982 |
| Molecular Formula | C14H20O6S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (3R,4S,5S)-2-(benzenesulfinyl)-3,4,5-trimethoxyoxan-2-ol |
| SMILES | CO[C@H]1[C@@H](OC)COC(O)(S(=O)c2ccccc2)[C@@H]1OC |
| InChI | InChI=1S/C14H20O6S/c1-17-11-9-20-14(15,13(19-3)12(11)18-2)21(16)10-7-5-4-6-8-10/h4-8,11-13,15H,9H2,1-3H3/t11-,12-,13+,14?,21?/m0/s1 |
| InChIKey | YYRFXXJSCUVROT-HSLIECSESA-N |
| XLogP | 0.52 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |