About 12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione
12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione (PubChem CID 139796186) has the molecular formula C29H22N2O3
and a molecular weight of 446.51 g/mol. Its IUPAC name is 12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione.
Molecular Properties
| Compound Name | 12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione |
| PubChem CID | 139796186 |
| Molecular Formula | C29H22N2O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | 12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione |
| SMILES | CCOc1cccc2c(=O)c3cc4c(cc3[nH]c12)c(=O)c1ccccc1n4Cc1ccccc1 |
| InChI | InChI=1S/C29H22N2O3/c1-2-34-26-14-8-12-20-27(26)30-23-15-22-25(16-21(23)29(20)33)31(17-18-9-4-3-5-10-18)24-13-7-6-11-19(24)28(22)32/h3-16H,2,17H2,1H3,(H,30,33) |
| InChIKey | KASIYYZIBVZJHB-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione?
The IUPAC name of 12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione (CID 139796186) is 12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione.
What is the SMILES notation for 12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione?
The canonical SMILES for 12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione is CCOc1cccc2c(=O)c3cc4c(cc3[nH]c12)c(=O)c1ccccc1n4Cc1ccccc1.
What is the InChIKey of 12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione?
The InChIKey is KASIYYZIBVZJHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H22N2O3/c1-2-34-26-14-8-12-20-27(26)30-23-15-22-25(16-21(23)29(20)33)31(17-18-9-4-3-5-10-18)24-13-7-6-11-19(24)28(22)32/h3-16H,2,17H2,1H3,(H,30,33).
What are the key properties of 12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione?
12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione has a molecular weight of 446.51 g/mol, XLogP of 5.60, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 12-benzyl-4-ethoxy-5H-quinolino[2,3-b]acridine-7,14-dione is sourced from PubChem (CID 139796186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).