C43H70O4 — CID 139796461
[(13Z,16Z,19Z)-4,7-dioxopentacosa-13,16,19-trienyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate (PubChem CID 139796461) has the molecular formula C43H70O4 and a molecular weight of 651.03 g/mol. Its IUPAC name is [(13Z,16Z,19Z)-4,7-dioxopentacosa-13,16,19-trienyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate.
| Compound Name | [(13Z,16Z,19Z)-4,7-dioxopentacosa-13,16,19-trienyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 139796461 |
| Molecular Formula | C43H70O4 |
| Molecular Weight | 651.03 g/mol |
| Exact Mass | 650.53 |
| IUPAC Name | [(13Z,16Z,19Z)-4,7-dioxopentacosa-13,16,19-trienyl] (6Z,9Z,12Z)-octadeca-6,9,12-trienoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCCC(=O)CCC(=O)CCCOC(=O)CCCC/C=C\C/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C43H70O4/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-35-41(44)38-39-42(45)36-34-40-47-43(46)37-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,22,24-25,27H,3-10,15-16,21,23,26,28-40H2,1-2H3/b13-11-,14-12-,19-17-,20-18-,24-22-,27-25- |
| InChIKey | GECLKLSVPBDYAA-UXTXDGNFSA-N |
| XLogP | 12.80 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.03 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|