C10H2F16O5 — CID 139796501
1,1,2,2,3-pentafluoro-3-[1,2,2,3,3-pentafluoro-3-hydroxy-1-(2,3,3-trifluorooxiran-2-yl)propoxy]-3-(2,3,3-trifluorooxiran-2-yl)propan-1-ol (PubChem CID 139796501) has the molecular formula C10H2F16O5 and a molecular weight of 506.09 g/mol. Its IUPAC name is 1,1,2,2,3-pentafluoro-3-[1,2,2,3,3-pentafluoro-3-hydroxy-1-(2,3,3-trifluorooxiran-2-yl)propoxy]-3-(2,3,3-trifluorooxiran-2-yl)propan-1-ol.
| Compound Name | 1,1,2,2,3-pentafluoro-3-[1,2,2,3,3-pentafluoro-3-hydroxy-1-(2,3,3-trifluorooxiran-2-yl)propoxy]-3-(2,3,3-trifluorooxiran-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 139796501 |
| Molecular Formula | C10H2F16O5 |
| Molecular Weight | 506.09 g/mol |
| Exact Mass | 505.96 |
| IUPAC Name | 1,1,2,2,3-pentafluoro-3-[1,2,2,3,3-pentafluoro-3-hydroxy-1-(2,3,3-trifluorooxiran-2-yl)propoxy]-3-(2,3,3-trifluorooxiran-2-yl)propan-1-ol |
| SMILES | OC(F)(F)C(F)(F)C(F)(OC(F)(C(F)(F)C(O)(F)F)C1(F)OC1(F)F)C1(F)OC1(F)F |
| InChI | InChI=1S/C10H2F16O5/c11-1(12,7(19,20)27)3(15,5(17)9(23,24)30-5)29-4(16,2(13,14)8(21,22)28)6(18)10(25,26)31-6/h27-28H |
| InChIKey | VAMDZKFVTYQLBB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 74.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.09 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|