About 1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate
1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate (PubChem CID 139796543) has the molecular formula C19H32O4
and a molecular weight of 324.46 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate.
Molecular Properties
| Compound Name | 1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate |
| PubChem CID | 139796543 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate |
| SMILES | C=C(/C=C(\C)C(=O)OC(C)(C)C)C(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C19H32O4/c1-8-10-11-16(9-2)13-22-17(20)14(3)12-15(4)18(21)23-19(5,6)7/h12,16H,3,8-11,13H2,1-2,4-7H3/b15-12+ |
| InChIKey | VYDMLBMTLDHVBP-NTCAYCPXSA-N |
| XLogP | 4.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate?
The IUPAC name of 1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate (CID 139796543) is 1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate.
What is the SMILES notation for 1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate?
The canonical SMILES for 1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate is C=C(/C=C(\C)C(=O)OC(C)(C)C)C(=O)OCC(CC)CCCC.
What is the InChIKey of 1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate?
The InChIKey is VYDMLBMTLDHVBP-NTCAYCPXSA-N. The full InChI is InChI=1S/C19H32O4/c1-8-10-11-16(9-2)13-22-17(20)14(3)12-15(4)18(21)23-19(5,6)7/h12,16H,3,8-11,13H2,1-2,4-7H3/b15-12+.
What are the key properties of 1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate?
1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate has a molecular weight of 324.46 g/mol, XLogP of 4.59, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-tert-butyl 5-O-(2-ethylhexyl) (E)-2-methyl-4-methylidenepent-2-enedioate is sourced from PubChem (CID 139796543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).