C24H30O5S — CID 139796984
tert-butyl 5-(4-methylphenyl)sulfonyloxytetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate (PubChem CID 139796984) has the molecular formula C24H30O5S and a molecular weight of 430.57 g/mol. Its IUPAC name is tert-butyl 5-(4-methylphenyl)sulfonyloxytetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate.
| Compound Name | tert-butyl 5-(4-methylphenyl)sulfonyloxytetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
|---|---|
| PubChem CID | 139796984 |
| Molecular Formula | C24H30O5S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | tert-butyl 5-(4-methylphenyl)sulfonyloxytetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate |
| SMILES | Cc1ccc(S(=O)(=O)OC2C3CC(C2C(=O)OC(C)(C)C)C2C4C=CC(C4)C32)cc1 |
| InChI | InChI=1S/C24H30O5S/c1-13-5-9-16(10-6-13)30(26,27)29-22-18-12-17(21(22)23(25)28-24(2,3)4)19-14-7-8-15(11-14)20(18)19/h5-10,14-15,17-22H,11-12H2,1-4H3 |
| InChIKey | NAGGDMWEKAODSD-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|