C23H29F3O2 — CID 139797025
tert-butyl 5-(trifluoromethyl)hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carboxylate (PubChem CID 139797025) has the molecular formula C23H29F3O2 and a molecular weight of 394.48 g/mol. Its IUPAC name is tert-butyl 5-(trifluoromethyl)hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carboxylate.
| Compound Name | tert-butyl 5-(trifluoromethyl)hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carboxylate |
|---|---|
| PubChem CID | 139797025 |
| Molecular Formula | C23H29F3O2 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | tert-butyl 5-(trifluoromethyl)hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1C2CC(C3C4CC(C5C6C=CC(C6)C45)C23)C1C(F)(F)F |
| InChI | InChI=1S/C23H29F3O2/c1-22(2,3)28-21(27)19-13-8-14(20(19)23(24,25)26)18-12-7-11(17(13)18)15-9-4-5-10(6-9)16(12)15/h4-5,9-20H,6-8H2,1-3H3 |
| InChIKey | VUEGQUAGSPKUJX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|