C23H31NO — CID 139797079
5-[(2-methylpropan-2-yl)oxymethyl]hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carbonitrile (PubChem CID 139797079) has the molecular formula C23H31NO and a molecular weight of 337.51 g/mol. Its IUPAC name is 5-[(2-methylpropan-2-yl)oxymethyl]hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carbonitrile.
| Compound Name | 5-[(2-methylpropan-2-yl)oxymethyl]hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carbonitrile |
|---|---|
| PubChem CID | 139797079 |
| Molecular Formula | C23H31NO |
| Molecular Weight | 337.51 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 5-[(2-methylpropan-2-yl)oxymethyl]hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carbonitrile |
| SMILES | CC(C)(C)OCC1C(C#N)C2CC1C1C3CC(C4C5C=CC(C5)C34)C21 |
| InChI | InChI=1S/C23H31NO/c1-23(2,3)25-10-18-14-7-13(17(18)9-24)21-15-8-16(22(14)21)20-12-5-4-11(6-12)19(15)20/h4-5,11-22H,6-8,10H2,1-3H3 |
| InChIKey | MOEUJNCTLOVFBT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|