C18H21NO — CID 139797092
5-hydroxyhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carbonitrile (PubChem CID 139797092) has the molecular formula C18H21NO and a molecular weight of 267.37 g/mol. Its IUPAC name is 5-hydroxyhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carbonitrile.
| Compound Name | 5-hydroxyhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carbonitrile |
|---|---|
| PubChem CID | 139797092 |
| Molecular Formula | C18H21NO |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 5-hydroxyhexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-ene-4-carbonitrile |
| SMILES | N#CC1C(O)C2CC1C1C3CC(C4C5C=CC(C5)C34)C21 |
| InChI | InChI=1S/C18H21NO/c19-6-13-9-4-12(18(13)20)17-11-5-10(16(9)17)14-7-1-2-8(3-7)15(11)14/h1-2,7-18,20H,3-5H2 |
| InChIKey | SOMNOKZVXUHPKI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|