C35H42O7S — CID 139797113
[7-(oxan-2-yloxycarbonyloxy)-6-octacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-15-enyl] 4-methylbenzenesulfonate (PubChem CID 139797113) has the molecular formula C35H42O7S and a molecular weight of 606.78 g/mol. Its IUPAC name is [7-(oxan-2-yloxycarbonyloxy)-6-octacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-15-enyl] 4-methylbenzenesulfonate.
| Compound Name | [7-(oxan-2-yloxycarbonyloxy)-6-octacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-15-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139797113 |
| Molecular Formula | C35H42O7S |
| Molecular Weight | 606.78 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | [7-(oxan-2-yloxycarbonyloxy)-6-octacyclo[10.6.1.13,10.15,8.114,17.02,11.04,9.013,18]docos-15-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2C3CC(C2OC(=O)OC2CCCCO2)C2C4CC(C32)C2C3CC(C5C6C=CC(C6)C35)C42)cc1 |
| InChI | InChI=1S/C35H42O7S/c1-16-5-9-19(10-6-16)43(37,38)42-34-25-15-24(33(34)41-35(36)40-26-4-2-3-11-39-26)31-22-14-23(32(25)31)30-21-13-20(29(22)30)27-17-7-8-18(12-17)28(21)27/h5-10,17-18,20-34H,2-4,11-15H2,1H3 |
| InChIKey | GMYVRLOGTTYREJ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.78 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|