C29H36O6S — CID 139797170
[5-[(2-methylpropan-2-yl)oxycarbonyloxy]-4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-enyl] 4-methylbenzenesulfonate (PubChem CID 139797170) has the molecular formula C29H36O6S and a molecular weight of 512.67 g/mol. Its IUPAC name is [5-[(2-methylpropan-2-yl)oxycarbonyloxy]-4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-enyl] 4-methylbenzenesulfonate.
| Compound Name | [5-[(2-methylpropan-2-yl)oxycarbonyloxy]-4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139797170 |
| Molecular Formula | C29H36O6S |
| Molecular Weight | 512.67 g/mol |
| Exact Mass | 512.22 |
| IUPAC Name | [5-[(2-methylpropan-2-yl)oxycarbonyloxy]-4-hexacyclo[6.6.1.13,6.110,13.02,7.09,14]heptadec-11-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC2C3CC(C2OC(=O)OC(C)(C)C)C2C4CC(C5C6C=CC(C6)C45)C32)cc1 |
| InChI | InChI=1S/C29H36O6S/c1-14-5-9-17(10-6-14)36(31,32)35-27-21-13-20(26(27)33-28(30)34-29(2,3)4)24-18-12-19(25(21)24)23-16-8-7-15(11-16)22(18)23/h5-10,15-16,18-27H,11-13H2,1-4H3 |
| InChIKey | OGCJEVUPPNEHBR-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.67 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|