C21H35N3 — CID 139797966
1,2-bis(8-azabicyclo[3.2.1]octan-1-yl)-8-azabicyclo[3.2.1]octane (PubChem CID 139797966) has the molecular formula C21H35N3 and a molecular weight of 329.53 g/mol. Its IUPAC name is 1,2-bis(8-azabicyclo[3.2.1]octan-1-yl)-8-azabicyclo[3.2.1]octane.
| Compound Name | 1,2-bis(8-azabicyclo[3.2.1]octan-1-yl)-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 139797966 |
| Molecular Formula | C21H35N3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.28 |
| IUPAC Name | 1,2-bis(8-azabicyclo[3.2.1]octan-1-yl)-8-azabicyclo[3.2.1]octane |
| SMILES | C1CC2CCC(C3CCC4CCC3(C35CCCC(CC3)N5)N4)(C1)N2 |
| InChI | InChI=1S/C21H35N3/c1-3-15-7-12-19(10-1,22-15)18-6-5-17-9-14-21(18,24-17)20-11-2-4-16(23-20)8-13-20/h15-18,22-24H,1-14H2 |
| InChIKey | ORMHRMPMBWYQPF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |