C28H38N2O7S — CID 139799639
ethyl 2-[[5-[(2,2-dimethyl-6-phenylmethoxy-3,4-dihydrochromen-4-yl)methylsulfonylamino]-2-oxopentyl]amino]acetate (PubChem CID 139799639) has the molecular formula C28H38N2O7S and a molecular weight of 546.69 g/mol. Its IUPAC name is ethyl 2-[[5-[(2,2-dimethyl-6-phenylmethoxy-3,4-dihydrochromen-4-yl)methylsulfonylamino]-2-oxopentyl]amino]acetate.
| Compound Name | ethyl 2-[[5-[(2,2-dimethyl-6-phenylmethoxy-3,4-dihydrochromen-4-yl)methylsulfonylamino]-2-oxopentyl]amino]acetate |
|---|---|
| PubChem CID | 139799639 |
| Molecular Formula | C28H38N2O7S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | ethyl 2-[[5-[(2,2-dimethyl-6-phenylmethoxy-3,4-dihydrochromen-4-yl)methylsulfonylamino]-2-oxopentyl]amino]acetate |
| SMILES | CCOC(=O)CNCC(=O)CCCNS(=O)(=O)CC1CC(C)(C)Oc2ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C28H38N2O7S/c1-4-35-27(32)18-29-17-23(31)11-8-14-30-38(33,34)20-22-16-28(2,3)37-26-13-12-24(15-25(22)26)36-19-21-9-6-5-7-10-21/h5-7,9-10,12-13,15,22,29-30H,4,8,11,14,16-20H2,1-3H3 |
| InChIKey | BQCSHVNRPLGEKC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|