About beryllium hexylazanide
beryllium hexylazanide (PubChem CID 139799741) has the molecular formula C12H28BeN2
and a molecular weight of 209.38 g/mol. Its IUPAC name is beryllium hexylazanide.
Molecular Properties
| Compound Name | beryllium hexylazanide |
| PubChem CID | 139799741 |
| Molecular Formula | C12H28BeN2 |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.24 |
| IUPAC Name | beryllium hexylazanide |
| SMILES | CCCCCC[NH-].CCCCCC[NH-].[Be+2] |
| InChI | InChI=1S/2C6H14N.Be/c2*1-2-3-4-5-6-7;/h2*7H,2-6H2,1H3;/q2*-1;+2 |
| InChIKey | LEMHQKAWQNFRDJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze beryllium hexylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of beryllium hexylazanide?
The IUPAC name of beryllium hexylazanide (CID 139799741) is beryllium hexylazanide.
What is the SMILES notation for beryllium hexylazanide?
The canonical SMILES for beryllium hexylazanide is CCCCCC[NH-].CCCCCC[NH-].[Be+2].
What is the InChIKey of beryllium hexylazanide?
The InChIKey is LEMHQKAWQNFRDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H14N.Be/c2*1-2-3-4-5-6-7;/h2*7H,2-6H2,1H3;/q2*-1;+2.
What are the key properties of beryllium hexylazanide?
beryllium hexylazanide has a molecular weight of 209.38 g/mol, XLogP of 4.86, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for beryllium hexylazanide is sourced from PubChem (CID 139799741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).