C23H35N3O9 — CID 139800082
[(2R,3R,4R,5S,6S)-6-[[deuterio(pyridin-2-ylmethyl)carbamoyl]oxymethyl]-3,4,5-trimethoxyoxan-2-yl]methyl 4-hydroxypiperidine-1-carboxylate (PubChem CID 139800082) has the molecular formula C23H35N3O9 and a molecular weight of 498.55 g/mol. Its IUPAC name is [(2R,3R,4R,5S,6S)-6-[[deuterio(pyridin-2-ylmethyl)carbamoyl]oxymethyl]-3,4,5-trimethoxyoxan-2-yl]methyl 4-hydroxypiperidine-1-carboxylate.
| Compound Name | [(2R,3R,4R,5S,6S)-6-[[deuterio(pyridin-2-ylmethyl)carbamoyl]oxymethyl]-3,4,5-trimethoxyoxan-2-yl]methyl 4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 139800082 |
| Molecular Formula | C23H35N3O9 |
| Molecular Weight | 498.55 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | [(2R,3R,4R,5S,6S)-6-[[deuterio(pyridin-2-ylmethyl)carbamoyl]oxymethyl]-3,4,5-trimethoxyoxan-2-yl]methyl 4-hydroxypiperidine-1-carboxylate |
| SMILES | [2H]N(Cc1ccccn1)C(=O)OC[C@@H]1O[C@H](COC(=O)N2CCC(O)CC2)[C@@H](OC)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C23H35N3O9/c1-30-19-17(13-33-22(28)25-12-15-6-4-5-9-24-15)35-18(20(31-2)21(19)32-3)14-34-23(29)26-10-7-16(27)8-11-26/h4-6,9,16-21,27H,7-8,10-14H2,1-3H3,(H,25,28)/t17-,18+,19-,20+,21+/m0/s1/i/hD |
| InChIKey | YJAKVBRLUYDQPF-DVURDNMZSA-N |
| XLogP | 0.71 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.55 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |