C24H27ClN2O4 — CID 139800133
2-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]butyl]-1,4-benzoxazepine-3,5-dione (PubChem CID 139800133) has the molecular formula C24H27ClN2O4 and a molecular weight of 442.94 g/mol. Its IUPAC name is 2-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]butyl]-1,4-benzoxazepine-3,5-dione.
| Compound Name | 2-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]butyl]-1,4-benzoxazepine-3,5-dione |
|---|---|
| PubChem CID | 139800133 |
| Molecular Formula | C24H27ClN2O4 |
| Molecular Weight | 442.94 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 2-[4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]butyl]-1,4-benzoxazepine-3,5-dione |
| SMILES | O=C1NC(=O)C(CCCCN2CCC(O)(c3ccc(Cl)cc3)CC2)Oc2ccccc21 |
| InChI | InChI=1S/C24H27ClN2O4/c25-18-10-8-17(9-11-18)24(30)12-15-27(16-13-24)14-4-3-7-21-23(29)26-22(28)19-5-1-2-6-20(19)31-21/h1-2,5-6,8-11,21,30H,3-4,7,12-16H2,(H,26,28,29) |
| InChIKey | NJYCVTGQRNGBRP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.94 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|