C32H40N2O6S — CID 139801057
N-[2-(hexanoylsulfamoyl)phenyl]-3,3-dimethyl-2,4-bis(phenylmethoxy)butanamide (PubChem CID 139801057) has the molecular formula C32H40N2O6S and a molecular weight of 580.75 g/mol. Its IUPAC name is N-[2-(hexanoylsulfamoyl)phenyl]-3,3-dimethyl-2,4-bis(phenylmethoxy)butanamide.
| Compound Name | N-[2-(hexanoylsulfamoyl)phenyl]-3,3-dimethyl-2,4-bis(phenylmethoxy)butanamide |
|---|---|
| PubChem CID | 139801057 |
| Molecular Formula | C32H40N2O6S |
| Molecular Weight | 580.75 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | N-[2-(hexanoylsulfamoyl)phenyl]-3,3-dimethyl-2,4-bis(phenylmethoxy)butanamide |
| SMILES | CCCCCC(=O)NS(=O)(=O)c1ccccc1NC(=O)C(OCc1ccccc1)C(C)(C)COCc1ccccc1 |
| InChI | InChI=1S/C32H40N2O6S/c1-4-5-8-21-29(35)34-41(37,38)28-20-14-13-19-27(28)33-31(36)30(40-23-26-17-11-7-12-18-26)32(2,3)24-39-22-25-15-9-6-10-16-25/h6-7,9-20,30H,4-5,8,21-24H2,1-3H3,(H,33,36)(H,34,35) |
| InChIKey | KMXSCXJQHGFHOM-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.75 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|