C27H31FN6O3 — CID 139801430
N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(1-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide (PubChem CID 139801430) has the molecular formula C27H31FN6O3 and a molecular weight of 506.58 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(1-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(1-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 139801430 |
| Molecular Formula | C27H31FN6O3 |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)piperazin-1-yl]ethyl]-N-(1-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide |
| SMILES | Cn1nc(N(CCN2CCN(c3ccc(F)cc3)CC2)C(=O)c2ccc([N+](=O)[O-])cc2)c2c1CCCC2 |
| InChI | InChI=1S/C27H31FN6O3/c1-30-25-5-3-2-4-24(25)26(29-30)33(27(35)20-6-10-23(11-7-20)34(36)37)19-16-31-14-17-32(18-15-31)22-12-8-21(28)9-13-22/h6-13H,2-5,14-19H2,1H3 |
| InChIKey | QIKUFXKJQAEHKN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 87.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|