C28H32FN5O3 — CID 139801604
N-[2-[4-(4-fluorophenyl)piperidin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide (PubChem CID 139801604) has the molecular formula C28H32FN5O3 and a molecular weight of 505.59 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)piperidin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)piperidin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 139801604 |
| Molecular Formula | C28H32FN5O3 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)piperidin-1-yl]ethyl]-N-(2-methyl-4,5,6,7-tetrahydroindazol-3-yl)-4-nitrobenzamide |
| SMILES | Cn1nc2c(c1N(CCN1CCC(c3ccc(F)cc3)CC1)C(=O)c1ccc([N+](=O)[O-])cc1)CCCC2 |
| InChI | InChI=1S/C28H32FN5O3/c1-31-27(25-4-2-3-5-26(25)30-31)33(28(35)22-8-12-24(13-9-22)34(36)37)19-18-32-16-14-21(15-17-32)20-6-10-23(29)11-7-20/h6-13,21H,2-5,14-19H2,1H3 |
| InChIKey | OVUKPVNUMDDPAB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|