C9H11ClN2O2 — CID 139801659
2-chloro-N-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)acetamide (PubChem CID 139801659) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is 2-chloro-N-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)acetamide.
| Compound Name | 2-chloro-N-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 139801659 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2-chloro-N-(4,5,6,7-tetrahydro-2,1-benzoxazol-3-yl)acetamide |
| SMILES | O=C(CCl)Nc1onc2c1CCCC2 |
| InChI | InChI=1S/C9H11ClN2O2/c10-5-8(13)11-9-6-3-1-2-4-7(6)12-14-9/h1-5H2,(H,11,13) |
| InChIKey | UOHWUYRDOZOVRJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|