C24H24F3N5O4S — CID 139802155
N-[7-[[(3S)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]sulfamoyl]-1,2,3,4-tetrahydroisoquinolin-1-yl]-3,3,3-trifluoropropanamide (PubChem CID 139802155) has the molecular formula C24H24F3N5O4S and a molecular weight of 535.55 g/mol. Its IUPAC name is N-[7-[[(3S)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]sulfamoyl]-1,2,3,4-tetrahydroisoquinolin-1-yl]-3,3,3-trifluoropropanamide.
| Compound Name | N-[7-[[(3S)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]sulfamoyl]-1,2,3,4-tetrahydroisoquinolin-1-yl]-3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 139802155 |
| Molecular Formula | C24H24F3N5O4S |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | N-[7-[[(3S)-1-[(3-cyanophenyl)methyl]-2-oxopyrrolidin-3-yl]sulfamoyl]-1,2,3,4-tetrahydroisoquinolin-1-yl]-3,3,3-trifluoropropanamide |
| SMILES | N#Cc1cccc(CN2CC[C@H](NS(=O)(=O)c3ccc4c(c3)C(NC(=O)CC(F)(F)F)NCC4)C2=O)c1 |
| InChI | InChI=1S/C24H24F3N5O4S/c25-24(26,27)12-21(33)30-22-19-11-18(5-4-17(19)6-8-29-22)37(35,36)31-20-7-9-32(23(20)34)14-16-3-1-2-15(10-16)13-28/h1-5,10-11,20,22,29,31H,6-9,12,14H2,(H,30,33)/t20-,22?/m0/s1 |
| InChIKey | MLHNBDKXJPCCAF-AIBWNMTMSA-N |
| XLogP | 1.85 |
| TPSA | 131.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |