C24H42O6Si — CID 139802520
(2,2-dimethyl-1,3-dioxolan-4-yl)methyl 7-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]heptanoate (PubChem CID 139802520) has the molecular formula C24H42O6Si and a molecular weight of 454.68 g/mol. Its IUPAC name is (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 7-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]heptanoate.
| Compound Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 7-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]heptanoate |
|---|---|
| PubChem CID | 139802520 |
| Molecular Formula | C24H42O6Si |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | (2,2-dimethyl-1,3-dioxolan-4-yl)methyl 7-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]heptanoate |
| SMILES | CC1(C)OCC(COC(=O)CCCCCCC2=C[C@H](O[Si](C)(C)C(C)(C)C)CC2=O)O1 |
| InChI | InChI=1S/C24H42O6Si/c1-23(2,3)31(6,7)30-19-14-18(21(25)15-19)12-10-8-9-11-13-22(26)27-16-20-17-28-24(4,5)29-20/h14,19-20H,8-13,15-17H2,1-7H3/t19-,20?/m0/s1 |
| InChIKey | QXSPQYIQODOREA-XJDOXCRVSA-N |
| XLogP | 5.31 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|