C12H27Cl2CoN4 — CID 139802939
dichlorocobalt(1+);1,5,9-triaza-13-azanidacyclohexadecane (PubChem CID 139802939) has the molecular formula C12H27Cl2CoN4 and a molecular weight of 357.22 g/mol. Its IUPAC name is dichlorocobalt(1+);1,5,9-triaza-13-azanidacyclohexadecane.
| Compound Name | dichlorocobalt(1+);1,5,9-triaza-13-azanidacyclohexadecane |
|---|---|
| PubChem CID | 139802939 |
| Molecular Formula | C12H27Cl2CoN4 |
| Molecular Weight | 357.22 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | dichlorocobalt(1+);1,5,9-triaza-13-azanidacyclohexadecane |
| SMILES | C1C[N-]CCCNCCCNCCCNC1.Cl[Co+]Cl |
| InChI | InChI=1S/C12H27N4.2ClH.Co/c1-5-13-7-2-9-15-11-4-12-16-10-3-8-14-6-1;;;/h13-15H,1-12H2;2*1H;/q-1;;;+3/p-2 |
| InChIKey | YLJCVRFUUYTICO-UHFFFAOYSA-L |
| XLogP | 2.08 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.22 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |