About ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride
ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride (PubChem CID 139804029) has the molecular formula C17H22ClN3O2S
and a molecular weight of 367.90 g/mol. Its IUPAC name is ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride |
| PubChem CID | 139804029 |
| Molecular Formula | C17H22ClN3O2S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride |
| SMILES | CCOC(=O)CNc1ccc2c(c1)sc1nc(C(C)(C)C)cn12.Cl |
| InChI | InChI=1S/C17H21N3O2S.ClH/c1-5-22-15(21)9-18-11-6-7-12-13(8-11)23-16-19-14(10-20(12)16)17(2,3)4;/h6-8,10,18H,5,9H2,1-4H3;1H |
| InChIKey | KTPDLDSHQNEIMC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride?
The IUPAC name of ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride (CID 139804029) is ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride.
What is the SMILES notation for ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride?
The canonical SMILES for ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride is CCOC(=O)CNc1ccc2c(c1)sc1nc(C(C)(C)C)cn12.Cl.
What is the InChIKey of ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride?
The InChIKey is KTPDLDSHQNEIMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O2S.ClH/c1-5-22-15(21)9-18-11-6-7-12-13(8-11)23-16-19-14(10-20(12)16)17(2,3)4;/h6-8,10,18H,5,9H2,1-4H3;1H.
What are the key properties of ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride?
ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride has a molecular weight of 367.90 g/mol, XLogP of 4.24, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2-tert-butylimidazo[2,1-b][1,3]benzothiazol-6-yl)amino]acetate;hydrochloride is sourced from PubChem (CID 139804029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).