About 6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one
6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one (PubChem CID 139804678) has the molecular formula C19H17BrFNO3
and a molecular weight of 406.25 g/mol. Its IUPAC name is 6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one.
Molecular Properties
| Compound Name | 6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one |
| PubChem CID | 139804678 |
| Molecular Formula | C19H17BrFNO3 |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 405.04 |
| IUPAC Name | 6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one |
| SMILES | CC1(C)OCC(Cn2c3ccc(F)cc3c(=O)c3ccc(Br)cc32)O1 |
| InChI | InChI=1S/C19H17BrFNO3/c1-19(2)24-10-13(25-19)9-22-16-6-4-12(21)8-15(16)18(23)14-5-3-11(20)7-17(14)22/h3-8,13H,9-10H2,1-2H3 |
| InChIKey | FETUYNWEBHIRHZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one?
The IUPAC name of 6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one (CID 139804678) is 6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one.
What is the SMILES notation for 6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one?
The canonical SMILES for 6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one is CC1(C)OCC(Cn2c3ccc(F)cc3c(=O)c3ccc(Br)cc32)O1.
What is the InChIKey of 6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one?
The InChIKey is FETUYNWEBHIRHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17BrFNO3/c1-19(2)24-10-13(25-19)9-22-16-6-4-12(21)8-15(16)18(23)14-5-3-11(20)7-17(14)22/h3-8,13H,9-10H2,1-2H3.
What are the key properties of 6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one?
6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one has a molecular weight of 406.25 g/mol, XLogP of 4.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-10-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-2-fluoroacridin-9-one is sourced from PubChem (CID 139804678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).