C27H29NO5 — CID 139804759
2-[5-(5,5-dimethyl-1,4,2-dioxazol-3-yl)-1-(4-methoxyphenyl)pentyl]-3-methylnaphthalene-1,4-dione (PubChem CID 139804759) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is 2-[5-(5,5-dimethyl-1,4,2-dioxazol-3-yl)-1-(4-methoxyphenyl)pentyl]-3-methylnaphthalene-1,4-dione.
| Compound Name | 2-[5-(5,5-dimethyl-1,4,2-dioxazol-3-yl)-1-(4-methoxyphenyl)pentyl]-3-methylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 139804759 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 2-[5-(5,5-dimethyl-1,4,2-dioxazol-3-yl)-1-(4-methoxyphenyl)pentyl]-3-methylnaphthalene-1,4-dione |
| SMILES | COc1ccc(C(CCCCC2=NOC(C)(C)O2)C2=C(C)C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C27H29NO5/c1-17-24(26(30)22-11-6-5-10-21(22)25(17)29)20(18-13-15-19(31-4)16-14-18)9-7-8-12-23-28-33-27(2,3)32-23/h5-6,10-11,13-16,20H,7-9,12H2,1-4H3 |
| InChIKey | ATSDKPUNPJPTHM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|